About 9-ethyloctadec-12-enoic acid
9-ethyloctadec-12-enoic acid (PubChem CID 91579793) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is 9-ethyloctadec-12-enoic acid.
Molecular Properties
| Compound Name | 9-ethyloctadec-12-enoic acid |
| PubChem CID | 91579793 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 9-ethyloctadec-12-enoic acid |
| SMILES | CCCCCC=CCCC(CC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O2/c1-3-5-6-7-8-10-13-16-19(4-2)17-14-11-9-12-15-18-20(21)22/h8,10,19H,3-7,9,11-18H2,1-2H3,(H,21,22) |
| InChIKey | OBPUBMFMWZUHDO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyloctadec-12-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyloctadec-12-enoic acid?
The IUPAC name of 9-ethyloctadec-12-enoic acid (CID 91579793) is 9-ethyloctadec-12-enoic acid.
What is the SMILES notation for 9-ethyloctadec-12-enoic acid?
The canonical SMILES for 9-ethyloctadec-12-enoic acid is CCCCCC=CCCC(CC)CCCCCCCC(=O)O.
What is the InChIKey of 9-ethyloctadec-12-enoic acid?
The InChIKey is OBPUBMFMWZUHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-3-5-6-7-8-10-13-16-19(4-2)17-14-11-9-12-15-18-20(21)22/h8,10,19H,3-7,9,11-18H2,1-2H3,(H,21,22).
What are the key properties of 9-ethyloctadec-12-enoic acid?
9-ethyloctadec-12-enoic acid has a molecular weight of 310.52 g/mol, XLogP of 6.74, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyloctadec-12-enoic acid is sourced from PubChem (CID 91579793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).