C20H13F6N5O3 — CID 163805981
5-[3-(difluoromethyl)-5-isocyanophenoxy]-3-[(2-methyl-6-oxo-1H-pyrimidin-5-yl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one (PubChem CID 163805981) has the molecular formula C20H13F6N5O3 and a molecular weight of 485.34 g/mol. Its IUPAC name is 5-[3-(difluoromethyl)-5-isocyanophenoxy]-3-[(2-methyl-6-oxo-1H-pyrimidin-5-yl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one.
| Compound Name | 5-[3-(difluoromethyl)-5-isocyanophenoxy]-3-[(2-methyl-6-oxo-1H-pyrimidin-5-yl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 163805981 |
| Molecular Formula | C20H13F6N5O3 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 5-[3-(difluoromethyl)-5-isocyanophenoxy]-3-[(2-methyl-6-oxo-1H-pyrimidin-5-yl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1cc(Oc2c(C(F)(F)C(F)F)ncn(Cc3cnc(C)[nH]c3=O)c2=O)cc(C(F)F)c1 |
| InChI | InChI=1S/C20H13F6N5O3/c1-9-28-6-11(17(32)30-9)7-31-8-29-15(20(25,26)19(23)24)14(18(31)33)34-13-4-10(16(21)22)3-12(5-13)27-2/h3-6,8,16,19H,7H2,1H3,(H,28,30,32) |
| InChIKey | NJCBMDOFCFGNFJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|