C14H7F6N3O2 — CID 163587605
5-[3-(difluoromethyl)-5-isocyanophenoxy]-4-(1,1,2,2-tetrafluoroethyl)-1H-pyrimidin-6-one (PubChem CID 163587605) has the molecular formula C14H7F6N3O2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 5-[3-(difluoromethyl)-5-isocyanophenoxy]-4-(1,1,2,2-tetrafluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[3-(difluoromethyl)-5-isocyanophenoxy]-4-(1,1,2,2-tetrafluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 163587605 |
| Molecular Formula | C14H7F6N3O2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 5-[3-(difluoromethyl)-5-isocyanophenoxy]-4-(1,1,2,2-tetrafluoroethyl)-1H-pyrimidin-6-one |
| SMILES | [C-]#[N+]c1cc(Oc2c(C(F)(F)C(F)F)nc[nH]c2=O)cc(C(F)F)c1 |
| InChI | InChI=1S/C14H7F6N3O2/c1-21-7-2-6(11(15)16)3-8(4-7)25-9-10(14(19,20)13(17)18)22-5-23-12(9)24/h2-5,11,13H,(H,22,23,24) |
| InChIKey | GMUHYSNQSPJWDD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|