C14H7ClF5N3O2 — CID 177324589
5-chloro-2-methyl-3-[[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-5-yl]oxy]benzonitrile (PubChem CID 177324589) has the molecular formula C14H7ClF5N3O2 and a molecular weight of 379.67 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-[[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-5-yl]oxy]benzonitrile.
| Compound Name | 5-chloro-2-methyl-3-[[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 177324589 |
| Molecular Formula | C14H7ClF5N3O2 |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 5-chloro-2-methyl-3-[[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-5-yl]oxy]benzonitrile |
| SMILES | Cc1c(C#N)cc(Cl)cc1Oc1c(C(F)(F)C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C14H7ClF5N3O2/c1-6-7(4-21)2-8(15)3-9(6)25-10-11(22-5-23-12(10)24)13(16,17)14(18,19)20/h2-3,5H,1H3,(H,22,23,24) |
| InChIKey | QAXQIYSWOVDEHW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|