C15H11Cl2NO — CID 63510537
5-chloro-2-(4-chloro-2,6-dimethylphenoxy)benzonitrile (PubChem CID 63510537) has the molecular formula C15H11Cl2NO and a molecular weight of 292.17 g/mol. Its IUPAC name is 5-chloro-2-(4-chloro-2,6-dimethylphenoxy)benzonitrile.
| Compound Name | 5-chloro-2-(4-chloro-2,6-dimethylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 63510537 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-chloro-2-(4-chloro-2,6-dimethylphenoxy)benzonitrile |
| SMILES | Cc1cc(Cl)cc(C)c1Oc1ccc(Cl)cc1C#N |
| InChI | InChI=1S/C15H11Cl2NO/c1-9-5-13(17)6-10(2)15(9)19-14-4-3-12(16)7-11(14)8-18/h3-7H,1-2H3 |
| InChIKey | BGASIAXHTPXBBL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |