C16H12ClNO2 — CID 114844943
4-(4-chloro-2-formylphenoxy)-3,5-dimethylbenzonitrile (PubChem CID 114844943) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is 4-(4-chloro-2-formylphenoxy)-3,5-dimethylbenzonitrile.
| Compound Name | 4-(4-chloro-2-formylphenoxy)-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 114844943 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-(4-chloro-2-formylphenoxy)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccc(Cl)cc1C=O |
| InChI | InChI=1S/C16H12ClNO2/c1-10-5-12(8-18)6-11(2)16(10)20-15-4-3-14(17)7-13(15)9-19/h3-7,9H,1-2H3 |
| InChIKey | BHRFQHJBGIMHIE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|