C9H9ClN2 — CID 163808025
2-chloro-3-methyl-1,8a-dihydroquinoxaline (PubChem CID 163808025) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 2-chloro-3-methyl-1,8a-dihydroquinoxaline.
| Compound Name | 2-chloro-3-methyl-1,8a-dihydroquinoxaline |
|---|---|
| PubChem CID | 163808025 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-chloro-3-methyl-1,8a-dihydroquinoxaline |
| SMILES | CC1=C(Cl)NC2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H9ClN2/c1-6-9(10)12-8-5-3-2-4-7(8)11-6/h2-5,8,12H,1H3 |
| InChIKey | NKTKTHVDSANWHT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|