C19H22IN3O3S — CID 163808094
ethyl 2-(8-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-iodopropyl)-1,3-thiazole-4-carboxylate (PubChem CID 163808094) has the molecular formula C19H22IN3O3S and a molecular weight of 499.37 g/mol. Its IUPAC name is ethyl 2-(8-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-iodopropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(8-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-iodopropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 163808094 |
| Molecular Formula | C19H22IN3O3S |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | ethyl 2-(8-carbamoyl-3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-iodopropyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N2CCc3cccc(C(N)=O)c3C2)sc1CCCI |
| InChI | InChI=1S/C19H22IN3O3S/c1-2-26-18(25)16-15(7-4-9-20)27-19(22-16)23-10-8-12-5-3-6-13(17(21)24)14(12)11-23/h3,5-6H,2,4,7-11H2,1H3,(H2,21,24) |
| InChIKey | NKVBASFZWWNOEI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|