C32H36N4O5S2Si — CID 59447560
ethyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-hydroxyprop-1-ynyl)-1,3-thiazole-4-carboxylate (PubChem CID 59447560) has the molecular formula C32H36N4O5S2Si and a molecular weight of 648.88 g/mol. Its IUPAC name is ethyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-hydroxyprop-1-ynyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-hydroxyprop-1-ynyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59447560 |
| Molecular Formula | C32H36N4O5S2Si |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | ethyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-hydroxyprop-1-ynyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N2CCc3cccc(C(=O)N(COCC[Si](C)(C)C)c4nc5ccccc5s4)c3C2)sc1C#CCO |
| InChI | InChI=1S/C32H36N4O5S2Si/c1-5-41-30(39)28-27(14-9-17-37)43-31(34-28)35-16-15-22-10-8-11-23(24(22)20-35)29(38)36(21-40-18-19-44(2,3)4)32-33-25-12-6-7-13-26(25)42-32/h6-8,10-13,37H,5,15-21H2,1-4H3 |
| InChIKey | RJBQRIGCLJIRNC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|