C37H38N4O4S2Si — CID 90000452
methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-phenylprop-1-ynyl)-1,3-thiazole-4-carboxylate (PubChem CID 90000452) has the molecular formula C37H38N4O4S2Si and a molecular weight of 694.96 g/mol. Its IUPAC name is methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-phenylprop-1-ynyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-phenylprop-1-ynyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 90000452 |
| Molecular Formula | C37H38N4O4S2Si |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | methyl 2-[8-[1,3-benzothiazol-2-yl(2-trimethylsilylethoxymethyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-5-(3-phenylprop-1-ynyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(N2CCc3cccc(C(=O)N(COCC[Si](C)(C)C)c4nc5ccccc5s4)c3C2)sc1C#CCc1ccccc1 |
| InChI | InChI=1S/C37H38N4O4S2Si/c1-44-35(43)33-32(19-10-14-26-12-6-5-7-13-26)47-36(39-33)40-21-20-27-15-11-16-28(29(27)24-40)34(42)41(25-45-22-23-48(2,3)4)37-38-30-17-8-9-18-31(30)46-37/h5-9,11-13,15-18H,14,20-25H2,1-4H3 |
| InChIKey | PPRPUUMYSJDYQP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|