About (4-oxopentanoylamino) hydrogen sulfite
(4-oxopentanoylamino) hydrogen sulfite (PubChem CID 163808582) has the molecular formula C5H9NO5S
and a molecular weight of 195.20 g/mol. Its IUPAC name is (4-oxopentanoylamino) hydrogen sulfite.
Molecular Properties
| Compound Name | (4-oxopentanoylamino) hydrogen sulfite |
| PubChem CID | 163808582 |
| Molecular Formula | C5H9NO5S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | (4-oxopentanoylamino) hydrogen sulfite |
| SMILES | CC(=O)CCC(=O)NOS(=O)O |
| InChI | InChI=1S/C5H9NO5S/c1-4(7)2-3-5(8)6-11-12(9)10/h2-3H2,1H3,(H,6,8)(H,9,10) |
| InChIKey | DFIWWVCYRUBSMS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (4-oxopentanoylamino) hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxopentanoylamino) hydrogen sulfite?
The IUPAC name of (4-oxopentanoylamino) hydrogen sulfite (CID 163808582) is (4-oxopentanoylamino) hydrogen sulfite.
What is the SMILES notation for (4-oxopentanoylamino) hydrogen sulfite?
The canonical SMILES for (4-oxopentanoylamino) hydrogen sulfite is CC(=O)CCC(=O)NOS(=O)O.
What is the InChIKey of (4-oxopentanoylamino) hydrogen sulfite?
The InChIKey is DFIWWVCYRUBSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO5S/c1-4(7)2-3-5(8)6-11-12(9)10/h2-3H2,1H3,(H,6,8)(H,9,10).
What are the key properties of (4-oxopentanoylamino) hydrogen sulfite?
(4-oxopentanoylamino) hydrogen sulfite has a molecular weight of 195.20 g/mol, XLogP of -0.46, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxopentanoylamino) hydrogen sulfite is sourced from PubChem (CID 163808582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).