About amino ethyl sulfite;hexane-2,5-dione
amino ethyl sulfite;hexane-2,5-dione (PubChem CID 54400985) has the molecular formula C8H17NO5S
and a molecular weight of 239.29 g/mol. Its IUPAC name is amino ethyl sulfite;hexane-2,5-dione.
Molecular Properties
| Compound Name | amino ethyl sulfite;hexane-2,5-dione |
| PubChem CID | 54400985 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | amino ethyl sulfite;hexane-2,5-dione |
| SMILES | CC(=O)CCC(C)=O.CCOS(=O)ON |
| InChI | InChI=1S/C6H10O2.C2H7NO3S/c1-5(7)3-4-6(2)8;1-2-5-7(4)6-3/h3-4H2,1-2H3;2-3H2,1H3 |
| InChIKey | VNKFWJNGYCTEKT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino ethyl sulfite;hexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino ethyl sulfite;hexane-2,5-dione?
The IUPAC name of amino ethyl sulfite;hexane-2,5-dione (CID 54400985) is amino ethyl sulfite;hexane-2,5-dione.
What is the SMILES notation for amino ethyl sulfite;hexane-2,5-dione?
The canonical SMILES for amino ethyl sulfite;hexane-2,5-dione is CC(=O)CCC(C)=O.CCOS(=O)ON.
What is the InChIKey of amino ethyl sulfite;hexane-2,5-dione?
The InChIKey is VNKFWJNGYCTEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H7NO3S/c1-5(7)3-4-6(2)8;1-2-5-7(4)6-3/h3-4H2,1-2H3;2-3H2,1H3.
What are the key properties of amino ethyl sulfite;hexane-2,5-dione?
amino ethyl sulfite;hexane-2,5-dione has a molecular weight of 239.29 g/mol, XLogP of 0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino ethyl sulfite;hexane-2,5-dione is sourced from PubChem (CID 54400985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).