C24H29NO4 — CID 163809019
2-[2-[4-[(1R,3S)-3-[4-[(methylideneamino)methyl]phenoxy]cyclohexyl]phenyl]ethoxy]acetic acid (PubChem CID 163809019) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[2-[4-[(1R,3S)-3-[4-[(methylideneamino)methyl]phenoxy]cyclohexyl]phenyl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[(1R,3S)-3-[4-[(methylideneamino)methyl]phenoxy]cyclohexyl]phenyl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 163809019 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[2-[4-[(1R,3S)-3-[4-[(methylideneamino)methyl]phenoxy]cyclohexyl]phenyl]ethoxy]acetic acid |
| SMILES | C=NCc1ccc(O[C@H]2CCC[C@@H](c3ccc(CCOCC(=O)O)cc3)C2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-25-16-19-7-11-22(12-8-19)29-23-4-2-3-21(15-23)20-9-5-18(6-10-20)13-14-28-17-24(26)27/h5-12,21,23H,1-4,13-17H2,(H,26,27)/t21-,23+/m1/s1 |
| InChIKey | NLPYBVJXZQKCOR-GGAORHGYSA-N |
| XLogP | 4.64 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|