C23H27FO4 — CID 139317009
2-[2-[4-[3-(3-fluoro-4-methylphenoxy)cyclohexyl]phenyl]ethoxy]acetic acid (PubChem CID 139317009) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[2-[4-[3-(3-fluoro-4-methylphenoxy)cyclohexyl]phenyl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[3-(3-fluoro-4-methylphenoxy)cyclohexyl]phenyl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 139317009 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[2-[4-[3-(3-fluoro-4-methylphenoxy)cyclohexyl]phenyl]ethoxy]acetic acid |
| SMILES | Cc1ccc(OC2CCCC(c3ccc(CCOCC(=O)O)cc3)C2)cc1F |
| InChI | InChI=1S/C23H27FO4/c1-16-5-10-21(14-22(16)24)28-20-4-2-3-19(13-20)18-8-6-17(7-9-18)11-12-27-15-23(25)26/h5-10,14,19-20H,2-4,11-13,15H2,1H3,(H,25,26) |
| InChIKey | LXMZRNVTGQOVHB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|