C24H24N4O2S — CID 163812412
5-hydroxy-N-[2-[2-methyl-2-(thietan-2-yl)propanimidoyl]indolizin-6-yl]-1H-indole-2-carboxamide (PubChem CID 163812412) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-hydroxy-N-[2-[2-methyl-2-(thietan-2-yl)propanimidoyl]indolizin-6-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-hydroxy-N-[2-[2-methyl-2-(thietan-2-yl)propanimidoyl]indolizin-6-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 163812412 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 5-hydroxy-N-[2-[2-methyl-2-(thietan-2-yl)propanimidoyl]indolizin-6-yl]-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\c1cc2ccc(NC(=O)c3cc4cc(O)ccc4[nH]3)cn2c1)C(C)(C)C1CCS1 |
| InChI | InChI=1S/C24H24N4O2S/c1-24(2,21-7-8-31-21)22(25)15-9-17-4-3-16(13-28(17)12-15)26-23(30)20-11-14-10-18(29)5-6-19(14)27-20/h3-6,9-13,21,25,27,29H,7-8H2,1-2H3,(H,26,30)/b25-22+ |
| InChIKey | NOKVQRGPMREYSF-YYDJUVGSSA-N |
| XLogP | 5.28 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|