C42H36NO2+ — CID 163813039
6-[6-(3-cyclohexa-1,3-dien-1-ylphenyl)spiro[1,2-dihydroxanthene-9,9'-3,4-dihydroxanthene]-3-yl]-1,2-dihydropyridin-1-ium (PubChem CID 163813039) has the molecular formula C42H36NO2+ and a molecular weight of 586.76 g/mol. Its IUPAC name is 6-[6-(3-cyclohexa-1,3-dien-1-ylphenyl)spiro[1,2-dihydroxanthene-9,9'-3,4-dihydroxanthene]-3-yl]-1,2-dihydropyridin-1-ium.
| Compound Name | 6-[6-(3-cyclohexa-1,3-dien-1-ylphenyl)spiro[1,2-dihydroxanthene-9,9'-3,4-dihydroxanthene]-3-yl]-1,2-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 163813039 |
| Molecular Formula | C42H36NO2+ |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | 6-[6-(3-cyclohexa-1,3-dien-1-ylphenyl)spiro[1,2-dihydroxanthene-9,9'-3,4-dihydroxanthene]-3-yl]-1,2-dihydropyridin-1-ium |
| SMILES | C1=CCCC(c2cccc(-c3ccc4c(c3)OC3=C(CCC(C5=CC=CC[NH2+]5)=C3)C43C4=C(CCC=C4)Oc4ccccc43)c2)=C1 |
| InChI | InChI=1S/C42H35NO2/c1-2-11-28(12-3-1)29-13-10-14-30(25-29)31-20-22-35-40(26-31)45-41-27-32(37-17-8-9-24-43-37)21-23-36(41)42(35)33-15-4-6-18-38(33)44-39-19-7-5-16-34(39)42/h1-2,4-6,8-11,13-18,20,22,25-27,43H,3,7,12,19,21,23-24H2/p+1 |
| InChIKey | NOYAEXAVESNJDN-UHFFFAOYSA-O |
| XLogP | 8.75 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |