C17H26N2O4 — CID 163816079
N-[1-hydroxy-4-[1-(oxan-2-yloxymethyl)cyclohexyl]azet-2-ylidene]acetamide (PubChem CID 163816079) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[1-hydroxy-4-[1-(oxan-2-yloxymethyl)cyclohexyl]azet-2-ylidene]acetamide.
| Compound Name | N-[1-hydroxy-4-[1-(oxan-2-yloxymethyl)cyclohexyl]azet-2-ylidene]acetamide |
|---|---|
| PubChem CID | 163816079 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[1-hydroxy-4-[1-(oxan-2-yloxymethyl)cyclohexyl]azet-2-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\C=C(C2(COC3CCCCO3)CCCCC2)N1O |
| InChI | InChI=1S/C17H26N2O4/c1-13(20)18-15-11-14(19(15)21)17(8-4-2-5-9-17)12-23-16-7-3-6-10-22-16/h11,16,21H,2-10,12H2,1H3/b18-15+ |
| InChIKey | AHOLQTALZINHQR-OBGWFSINSA-N |
| XLogP | 3.01 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|