C24H28N4O3S — CID 163817075
2-nitroso-N-[[4-[(quinolin-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 163817075) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-nitroso-N-[[4-[(quinolin-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | 2-nitroso-N-[[4-[(quinolin-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 163817075 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-nitroso-N-[[4-[(quinolin-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=Nc1ccccc1S(=O)(=O)NCC1CCC(CNCc2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C24H28N4O3S/c29-28-23-7-3-4-8-24(23)32(30,31)26-16-19-11-9-18(10-12-19)15-25-17-21-14-13-20-5-1-2-6-22(20)27-21/h1-8,13-14,18-19,25-26H,9-12,15-17H2 |
| InChIKey | NSGNANVBWZZSLL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |