C15H18N2O2S — CID 81039352
1-(1,1-dioxothiolan-2-yl)-N-(quinolin-2-ylmethyl)methanamine (PubChem CID 81039352) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-2-yl)-N-(quinolin-2-ylmethyl)methanamine.
| Compound Name | 1-(1,1-dioxothiolan-2-yl)-N-(quinolin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 81039352 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-2-yl)-N-(quinolin-2-ylmethyl)methanamine |
| SMILES | O=S1(=O)CCCC1CNCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H18N2O2S/c18-20(19)9-3-5-14(20)11-16-10-13-8-7-12-4-1-2-6-15(12)17-13/h1-2,4,6-8,14,16H,3,5,9-11H2 |
| InChIKey | XCZGOCHVUCGANP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |