C21H20N2O4 — CID 163818652
1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]-3-naphthalen-1-ylurea (PubChem CID 163818652) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 163818652 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]-3-naphthalen-1-ylurea |
| SMILES | COc1cc(OC)cc(C(=O)CNC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H20N2O4/c1-26-16-10-15(11-17(12-16)27-2)20(24)13-22-21(25)23-19-9-5-7-14-6-3-4-8-18(14)19/h3-12H,13H2,1-2H3,(H2,22,23,25) |
| InChIKey | NTNOHBDTZHHIJE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |