C34H32O — CID 163820792
(E)-1-(4-methylphenyl)-3-[4-[2-[4-[(E)-1-(4-methylphenyl)prop-1-en-2-yl]phenyl]ethyl]phenyl]prop-2-en-1-one (PubChem CID 163820792) has the molecular formula C34H32O and a molecular weight of 456.63 g/mol. Its IUPAC name is (E)-1-(4-methylphenyl)-3-[4-[2-[4-[(E)-1-(4-methylphenyl)prop-1-en-2-yl]phenyl]ethyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methylphenyl)-3-[4-[2-[4-[(E)-1-(4-methylphenyl)prop-1-en-2-yl]phenyl]ethyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163820792 |
| Molecular Formula | C34H32O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (E)-1-(4-methylphenyl)-3-[4-[2-[4-[(E)-1-(4-methylphenyl)prop-1-en-2-yl]phenyl]ethyl]phenyl]prop-2-en-1-one |
| SMILES | C/C(=C\c1ccc(C)cc1)c1ccc(CCc2ccc(/C=C/C(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H32O/c1-25-4-8-31(9-5-25)24-27(3)32-21-16-30(17-22-32)15-12-28-10-13-29(14-11-28)18-23-34(35)33-19-6-26(2)7-20-33/h4-11,13-14,16-24H,12,15H2,1-3H3/b23-18+,27-24+ |
| InChIKey | NVFKEBPDDKKMFI-VBZCSJOGSA-N |
| XLogP | 8.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|