C22H29N — CID 163822378
9-[(2S,3R,4S)-3,4,5-trimethylheptan-2-yl]carbazole (PubChem CID 163822378) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 9-[(2S,3R,4S)-3,4,5-trimethylheptan-2-yl]carbazole.
| Compound Name | 9-[(2S,3R,4S)-3,4,5-trimethylheptan-2-yl]carbazole |
|---|---|
| PubChem CID | 163822378 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 9-[(2S,3R,4S)-3,4,5-trimethylheptan-2-yl]carbazole |
| SMILES | CCC(C)[C@H](C)[C@@H](C)[C@H](C)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C22H29N/c1-6-15(2)16(3)17(4)18(5)23-21-13-9-7-11-19(21)20-12-8-10-14-22(20)23/h7-18H,6H2,1-5H3/t15?,16-,17+,18-/m0/s1 |
| InChIKey | NWMZDHGFCCDKJD-FBVQUNGASA-N |
| XLogP | 6.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |