C20H25N — CID 123957864
9-(2,5-dimethylhexan-3-yl)carbazole (PubChem CID 123957864) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 9-(2,5-dimethylhexan-3-yl)carbazole.
| Compound Name | 9-(2,5-dimethylhexan-3-yl)carbazole |
|---|---|
| PubChem CID | 123957864 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 9-(2,5-dimethylhexan-3-yl)carbazole |
| SMILES | CC(C)CC(C(C)C)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C20H25N/c1-14(2)13-20(15(3)4)21-18-11-7-5-9-16(18)17-10-6-8-12-19(17)21/h5-12,14-15,20H,13H2,1-4H3 |
| InChIKey | KXIDTEINZVJLFV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |