C29H45N — CID 162006022
1-methyl-2,9-di(propan-2-yl)carbazole;2,4,6-trimethylheptane (PubChem CID 162006022) has the molecular formula C29H45N and a molecular weight of 407.69 g/mol. Its IUPAC name is 1-methyl-2,9-di(propan-2-yl)carbazole;2,4,6-trimethylheptane.
| Compound Name | 1-methyl-2,9-di(propan-2-yl)carbazole;2,4,6-trimethylheptane |
|---|---|
| PubChem CID | 162006022 |
| Molecular Formula | C29H45N |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 407.36 |
| IUPAC Name | 1-methyl-2,9-di(propan-2-yl)carbazole;2,4,6-trimethylheptane |
| SMILES | CC(C)CC(C)CC(C)C.Cc1c(C(C)C)ccc2c3ccccc3n(C(C)C)c12 |
| InChI | InChI=1S/C19H23N.C10H22/c1-12(2)15-10-11-17-16-8-6-7-9-18(16)20(13(3)4)19(17)14(15)5;1-8(2)6-10(5)7-9(3)4/h6-13H,1-5H3;8-10H,6-7H2,1-5H3 |
| InChIKey | YSVQPRPTALYZTR-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |