C6H10OS — CID 163822537
(5-methyl-2,3-dihydrothiophen-3-yl)methanol (PubChem CID 163822537) has the molecular formula C6H10OS and a molecular weight of 130.21 g/mol. Its IUPAC name is (5-methyl-2,3-dihydrothiophen-3-yl)methanol.
| Compound Name | (5-methyl-2,3-dihydrothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 163822537 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (5-methyl-2,3-dihydrothiophen-3-yl)methanol |
| SMILES | CC1=CC(CO)CS1 |
| InChI | InChI=1S/C6H10OS/c1-5-2-6(3-7)4-8-5/h2,6-7H,3-4H2,1H3 |
| InChIKey | NWQFTMQQRPQBGL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |