C7H12OS — CID 19003454
(5,5-dimethyl-2H-thiophen-3-yl)methanol (PubChem CID 19003454) has the molecular formula C7H12OS and a molecular weight of 144.24 g/mol. Its IUPAC name is (5,5-dimethyl-2H-thiophen-3-yl)methanol.
| Compound Name | (5,5-dimethyl-2H-thiophen-3-yl)methanol |
|---|---|
| PubChem CID | 19003454 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (5,5-dimethyl-2H-thiophen-3-yl)methanol |
| SMILES | CC1(C)C=C(CO)CS1 |
| InChI | InChI=1S/C7H12OS/c1-7(2)3-6(4-8)5-9-7/h3,8H,4-5H2,1-2H3 |
| InChIKey | HNJXJCXHCBXRNK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|