C12H22OS — CID 162417045
(2E)-3,7-dimethyl-9-methylsulfanylnona-2,6-dien-1-ol (PubChem CID 162417045) has the molecular formula C12H22OS and a molecular weight of 214.37 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-9-methylsulfanylnona-2,6-dien-1-ol.
| Compound Name | (2E)-3,7-dimethyl-9-methylsulfanylnona-2,6-dien-1-ol |
|---|---|
| PubChem CID | 162417045 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2E)-3,7-dimethyl-9-methylsulfanylnona-2,6-dien-1-ol |
| SMILES | CSCCC(C)=CCC/C(C)=C/CO |
| InChI | InChI=1S/C12H22OS/c1-11(7-9-13)5-4-6-12(2)8-10-14-3/h6-7,13H,4-5,8-10H2,1-3H3/b11-7+,12-6? |
| InChIKey | JGYOEPLUUUBHKR-DLQOAAMJSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|