C8H15N3O2 — CID 163824061
5-[ethyl(methyl)amino]-1-methyl-1,3-diazinane-2,4-dione (PubChem CID 163824061) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-1-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-[ethyl(methyl)amino]-1-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 163824061 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-[ethyl(methyl)amino]-1-methyl-1,3-diazinane-2,4-dione |
| SMILES | CCN(C)C1CN(C)C(=O)NC1=O |
| InChI | InChI=1S/C8H15N3O2/c1-4-10(2)6-5-11(3)8(13)9-7(6)12/h6H,4-5H2,1-3H3,(H,9,12,13) |
| InChIKey | NXWVQQVFGPCVRZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |