C7H12N4P- — CID 163825249
(1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-ylidene)azanide (PubChem CID 163825249) has the molecular formula C7H12N4P- and a molecular weight of 183.17 g/mol. Its IUPAC name is (1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-ylidene)azanide.
| Compound Name | (1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-ylidene)azanide |
|---|---|
| PubChem CID | 163825249 |
| Molecular Formula | C7H12N4P- |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-ylidene)azanide |
| SMILES | C=C1N(C)C(=[N-])N(C)C(=C)N1P |
| InChI | InChI=1S/C7H12N4P/c1-5-9(3)7(8)10(4)6(2)11(5)12/h1-2,12H2,3-4H3/q-1 |
| InChIKey | NYXGUWJEPOXRFQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 32.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|