C7H13N4P — CID 163825250
1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-imine (PubChem CID 163825250) has the molecular formula C7H13N4P and a molecular weight of 184.18 g/mol. Its IUPAC name is 1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-imine.
| Compound Name | 1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-imine |
|---|---|
| PubChem CID | 163825250 |
| Molecular Formula | C7H13N4P |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1,3-dimethyl-4,6-dimethylidene-5-phosphanyl-1,3,5-triazinan-2-imine |
| SMILES | [H]N=C1N(C)C(=C)N(P)C(=C)N1C |
| InChI | InChI=1S/C7H13N4P/c1-5-9(3)7(8)10(4)6(2)11(5)12/h8H,1-2,12H2,3-4H3 |
| InChIKey | KCBAOTOLHJQFSK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|