C20H20ClFN4 — CID 163825319
1-(3-chlorophenyl)-4-[[3-(4-fluorophenyl)-3H-pyrazol-4-yl]methyl]piperazine (PubChem CID 163825319) has the molecular formula C20H20ClFN4 and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[[3-(4-fluorophenyl)-3H-pyrazol-4-yl]methyl]piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[[3-(4-fluorophenyl)-3H-pyrazol-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 163825319 |
| Molecular Formula | C20H20ClFN4 |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[[3-(4-fluorophenyl)-3H-pyrazol-4-yl]methyl]piperazine |
| SMILES | Fc1ccc(C2N=NC=C2CN2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H20ClFN4/c21-17-2-1-3-19(12-17)26-10-8-25(9-11-26)14-16-13-23-24-20(16)15-4-6-18(22)7-5-15/h1-7,12-13,20H,8-11,14H2 |
| InChIKey | NYYVFYRKAZXDME-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |