C56H36F4N4 — CID 163826518
N-[(Z)-1,3-bis(3-fluorophenyl)-3-iminoprop-1-enyl]-4-[10-[4-[3,5-bis(3-fluorophenyl)pyrazol-1-yl]phenyl]anthracen-9-yl]aniline (PubChem CID 163826518) has the molecular formula C56H36F4N4 and a molecular weight of 840.92 g/mol. Its IUPAC name is N-[(Z)-1,3-bis(3-fluorophenyl)-3-iminoprop-1-enyl]-4-[10-[4-[3,5-bis(3-fluorophenyl)pyrazol-1-yl]phenyl]anthracen-9-yl]aniline.
| Compound Name | N-[(Z)-1,3-bis(3-fluorophenyl)-3-iminoprop-1-enyl]-4-[10-[4-[3,5-bis(3-fluorophenyl)pyrazol-1-yl]phenyl]anthracen-9-yl]aniline |
|---|---|
| PubChem CID | 163826518 |
| Molecular Formula | C56H36F4N4 |
| Molecular Weight | 840.92 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | N-[(Z)-1,3-bis(3-fluorophenyl)-3-iminoprop-1-enyl]-4-[10-[4-[3,5-bis(3-fluorophenyl)pyrazol-1-yl]phenyl]anthracen-9-yl]aniline |
| SMILES | [H]/N=C(/C=C(\Nc1ccc(-c2c3ccccc3c(-c3ccc(-n4nc(-c5cccc(F)c5)cc4-c4cccc(F)c4)cc3)c3ccccc23)cc1)c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C56H36F4N4/c57-41-13-5-9-37(29-41)51(61)33-52(38-10-6-14-42(58)30-38)62-45-25-21-35(22-26-45)55-47-17-1-3-19-49(47)56(50-20-4-2-18-48(50)55)36-23-27-46(28-24-36)64-54(40-12-8-16-44(60)32-40)34-53(63-64)39-11-7-15-43(59)31-39/h1-34,61-62H/b52-33-,61-51- |
| InChIKey | NZYFLGCLXSKNEX-GLLHQYRYSA-N |
| XLogP | 14.92 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.92 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|