About N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide
N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide (PubChem CID 163827421) has the molecular formula C13H27NOS3
and a molecular weight of 309.57 g/mol. Its IUPAC name is N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide.
Molecular Properties
| Compound Name | N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide |
| PubChem CID | 163827421 |
| Molecular Formula | C13H27NOS3 |
| Molecular Weight | 309.57 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide |
| SMILES | CC(=O)NCC(CCCS)(CCCS)CCCS |
| InChI | InChI=1S/C13H27NOS3/c1-12(15)14-11-13(5-2-8-16,6-3-9-17)7-4-10-18/h16-18H,2-11H2,1H3,(H,14,15) |
| InChIKey | OARUNRXQTSMKEY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide?
The IUPAC name of N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide (CID 163827421) is N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide.
What is the SMILES notation for N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide?
The canonical SMILES for N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide is CC(=O)NCC(CCCS)(CCCS)CCCS.
What is the InChIKey of N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide?
The InChIKey is OARUNRXQTSMKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NOS3/c1-12(15)14-11-13(5-2-8-16,6-3-9-17)7-4-10-18/h16-18H,2-11H2,1H3,(H,14,15).
What are the key properties of N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide?
N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide has a molecular weight of 309.57 g/mol, XLogP of 3.24, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide is sourced from PubChem (CID 163827421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).