C13H27NOS3 — CID 163827421
N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide (PubChem CID 163827421) has the molecular formula C13H27NOS3 and a molecular weight of 309.57 g/mol. Its IUPAC name is N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide.
| Compound Name | N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide |
|---|---|
| PubChem CID | 163827421 |
| Molecular Formula | C13H27NOS3 |
| Molecular Weight | 309.57 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[5-sulfanyl-2,2-bis(3-sulfanylpropyl)pentyl]acetamide |
| SMILES | CC(=O)NCC(CCCS)(CCCS)CCCS |
| InChI | InChI=1S/C13H27NOS3/c1-12(15)14-11-13(5-2-8-16,6-3-9-17)7-4-10-18/h16-18H,2-11H2,1H3,(H,14,15) |
| InChIKey | OARUNRXQTSMKEY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|