C16H32N2O3S — CID 144955127
4-(1-acetamido-3-methyl-6-sulfanylhexan-3-yl)oxy-N,2,2-trimethylbutanamide (PubChem CID 144955127) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is 4-(1-acetamido-3-methyl-6-sulfanylhexan-3-yl)oxy-N,2,2-trimethylbutanamide.
| Compound Name | 4-(1-acetamido-3-methyl-6-sulfanylhexan-3-yl)oxy-N,2,2-trimethylbutanamide |
|---|---|
| PubChem CID | 144955127 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-(1-acetamido-3-methyl-6-sulfanylhexan-3-yl)oxy-N,2,2-trimethylbutanamide |
| SMILES | CNC(=O)C(C)(C)CCOC(C)(CCCS)CCNC(C)=O |
| InChI | InChI=1S/C16H32N2O3S/c1-13(19)18-10-8-16(4,7-6-12-22)21-11-9-15(2,3)14(20)17-5/h22H,6-12H2,1-5H3,(H,17,20)(H,18,19) |
| InChIKey | ORDKNTOPSVVPNW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|