C23H32FN3O — CID 163827884
N-(1-cyclohexa-2,4-dien-1-ylethyl)-5-(2-fluorophenyl)-1-pentylpyrazolidine-3-carboxamide (PubChem CID 163827884) has the molecular formula C23H32FN3O and a molecular weight of 385.53 g/mol. Its IUPAC name is N-(1-cyclohexa-2,4-dien-1-ylethyl)-5-(2-fluorophenyl)-1-pentylpyrazolidine-3-carboxamide.
| Compound Name | N-(1-cyclohexa-2,4-dien-1-ylethyl)-5-(2-fluorophenyl)-1-pentylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 163827884 |
| Molecular Formula | C23H32FN3O |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | N-(1-cyclohexa-2,4-dien-1-ylethyl)-5-(2-fluorophenyl)-1-pentylpyrazolidine-3-carboxamide |
| SMILES | CCCCCN1NC(C(=O)NC(C)C2C=CC=CC2)CC1c1ccccc1F |
| InChI | InChI=1S/C23H32FN3O/c1-3-4-10-15-27-22(19-13-8-9-14-20(19)24)16-21(26-27)23(28)25-17(2)18-11-6-5-7-12-18/h5-9,11,13-14,17-18,21-22,26H,3-4,10,12,15-16H2,1-2H3,(H,25,28) |
| InChIKey | OBCMBJYFMIOEFD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|