C12H15N — CID 163828727
3-propyl-2,3-dihydroquinoline (PubChem CID 163828727) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-propyl-2,3-dihydroquinoline.
| Compound Name | 3-propyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 163828727 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-propyl-2,3-dihydroquinoline |
| SMILES | CCCC1C=c2ccccc2=NC1 |
| InChI | InChI=1S/C12H15N/c1-2-5-10-8-11-6-3-4-7-12(11)13-9-10/h3-4,6-8,10H,2,5,9H2,1H3 |
| InChIKey | OBUWXEDDIABWPM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |