C32H41N7O7 — CID 163829315
4-amino-3-[[3-(1H-indol-3-yl)-2-[2-[2-[(4-methylphenyl)carbamoylamino]propanoylamino]hexanoylamino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 163829315) has the molecular formula C32H41N7O7 and a molecular weight of 635.72 g/mol. Its IUPAC name is 4-amino-3-[[3-(1H-indol-3-yl)-2-[2-[2-[(4-methylphenyl)carbamoylamino]propanoylamino]hexanoylamino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-3-[[3-(1H-indol-3-yl)-2-[2-[2-[(4-methylphenyl)carbamoylamino]propanoylamino]hexanoylamino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163829315 |
| Molecular Formula | C32H41N7O7 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | 4-amino-3-[[3-(1H-indol-3-yl)-2-[2-[2-[(4-methylphenyl)carbamoylamino]propanoylamino]hexanoylamino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CCCCC(NC(=O)C(C)NC(=O)Nc1ccc(C)cc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(N)=O |
| InChI | InChI=1S/C32H41N7O7/c1-4-5-9-24(37-29(43)19(3)35-32(46)36-21-13-11-18(2)12-14-21)30(44)39-26(31(45)38-25(28(33)42)16-27(40)41)15-20-17-34-23-10-7-6-8-22(20)23/h6-8,10-14,17,19,24-26,34H,4-5,9,15-16H2,1-3H3,(H2,33,42)(H,37,43)(H,38,45)(H,39,44)(H,40,41)(H2,35,36,46) |
| InChIKey | OCHPHAFXPONPFG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 224.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |