C10H12N2S2 — CID 163829527
2-(2,3-dihydropyridin-6-yldisulfanyl)-2,3-dihydropyridine (PubChem CID 163829527) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(2,3-dihydropyridin-6-yldisulfanyl)-2,3-dihydropyridine.
| Compound Name | 2-(2,3-dihydropyridin-6-yldisulfanyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 163829527 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(2,3-dihydropyridin-6-yldisulfanyl)-2,3-dihydropyridine |
| SMILES | C1=CCC(SSC2=NCCC=C2)N=C1 |
| InChI | InChI=1S/C10H12N2S2/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | OCLZBEPZKJMIDA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|