C35H64IN2O5SSi+ — CID 163829907
[2-[(5-iodo-2-methoxycarbonylthiophen-3-yl)-(4-methylcyclohexanecarbonyl)amino]-3-tri(propan-2-yl)silyloxypropoxy]-tri(propan-2-yl)azanium (PubChem CID 163829907) has the molecular formula C35H64IN2O5SSi+ and a molecular weight of 779.96 g/mol. Its IUPAC name is [2-[(5-iodo-2-methoxycarbonylthiophen-3-yl)-(4-methylcyclohexanecarbonyl)amino]-3-tri(propan-2-yl)silyloxypropoxy]-tri(propan-2-yl)azanium.
| Compound Name | [2-[(5-iodo-2-methoxycarbonylthiophen-3-yl)-(4-methylcyclohexanecarbonyl)amino]-3-tri(propan-2-yl)silyloxypropoxy]-tri(propan-2-yl)azanium |
|---|---|
| PubChem CID | 163829907 |
| Molecular Formula | C35H64IN2O5SSi+ |
| Molecular Weight | 779.96 g/mol |
| Exact Mass | 779.33 |
| IUPAC Name | [2-[(5-iodo-2-methoxycarbonylthiophen-3-yl)-(4-methylcyclohexanecarbonyl)amino]-3-tri(propan-2-yl)silyloxypropoxy]-tri(propan-2-yl)azanium |
| SMILES | COC(=O)c1sc(I)cc1N(C(=O)C1CCC(C)CC1)C(CO[N+](C(C)C)(C(C)C)C(C)C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H64IN2O5SSi/c1-22(2)38(23(3)4,24(5)6)42-20-30(21-43-45(25(7)8,26(9)10)27(11)12)37(34(39)29-17-15-28(13)16-18-29)31-19-32(36)44-33(31)35(40)41-14/h19,22-30H,15-18,20-21H2,1-14H3/q+1 |
| InChIKey | YNDKTKMPXVACNB-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.96 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|