C17H26BNO3S — CID 145493279
methyl 5-boranyl-3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]thiophene-2-carboxylate (PubChem CID 145493279) has the molecular formula C17H26BNO3S and a molecular weight of 335.28 g/mol. Its IUPAC name is methyl 5-boranyl-3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-boranyl-3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 145493279 |
| Molecular Formula | C17H26BNO3S |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl 5-boranyl-3-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]thiophene-2-carboxylate |
| SMILES | Bc1cc(N(C(=O)C2CCC(C)CC2)C(C)C)c(C(=O)OC)s1 |
| InChI | InChI=1S/C17H26BNO3S/c1-10(2)19(16(20)12-7-5-11(3)6-8-12)13-9-14(18)23-15(13)17(21)22-4/h9-12H,5-8,18H2,1-4H3 |
| InChIKey | HMBAUVDYKQGRNA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|