C21H33NO4 — CID 143518887
ethane;methyl 5-hydroxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoate (PubChem CID 143518887) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethane;methyl 5-hydroxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoate.
| Compound Name | ethane;methyl 5-hydroxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoate |
|---|---|
| PubChem CID | 143518887 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | ethane;methyl 5-hydroxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoate |
| SMILES | CC.COC(=O)c1cc(O)ccc1N(C(=O)C1CCC(C)CC1)C(C)C |
| InChI | InChI=1S/C19H27NO4.C2H6/c1-12(2)20(18(22)14-7-5-13(3)6-8-14)17-10-9-15(21)11-16(17)19(23)24-4;1-2/h9-14,21H,5-8H2,1-4H3;1-2H3 |
| InChIKey | YRRSVFDLUWTQLC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |