C22H29NOS — CID 70834124
4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 70834124) has the molecular formula C22H29NOS and a molecular weight of 355.55 g/mol. Its IUPAC name is 4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 70834124 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | Cc1sc(-c2ccccc2)cc1N(C(=O)C1CCC(C)CC1)C(C)C |
| InChI | InChI=1S/C22H29NOS/c1-15(2)23(22(24)19-12-10-16(3)11-13-19)20-14-21(25-17(20)4)18-8-6-5-7-9-18/h5-9,14-16,19H,10-13H2,1-4H3 |
| InChIKey | VZSTWBKPWRMFRV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |