C24H31NOS — CID 89274940
1-[3-[1-(4-methylcyclohexyl)ethenyl-propan-2-ylamino]-5-phenylthiophen-2-yl]ethenol (PubChem CID 89274940) has the molecular formula C24H31NOS and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-[3-[1-(4-methylcyclohexyl)ethenyl-propan-2-ylamino]-5-phenylthiophen-2-yl]ethenol.
| Compound Name | 1-[3-[1-(4-methylcyclohexyl)ethenyl-propan-2-ylamino]-5-phenylthiophen-2-yl]ethenol |
|---|---|
| PubChem CID | 89274940 |
| Molecular Formula | C24H31NOS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[3-[1-(4-methylcyclohexyl)ethenyl-propan-2-ylamino]-5-phenylthiophen-2-yl]ethenol |
| SMILES | C=C(O)c1sc(-c2ccccc2)cc1N(C(=C)C1CCC(C)CC1)C(C)C |
| InChI | InChI=1S/C24H31NOS/c1-16(2)25(18(4)20-13-11-17(3)12-14-20)22-15-23(27-24(22)19(5)26)21-9-7-6-8-10-21/h6-10,15-17,20,26H,4-5,11-14H2,1-3H3 |
| InChIKey | OBLIFFPEJDJURJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|