C22H25NO4S — CID 59752367
methyl 3-[(4-oxocyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylate (PubChem CID 59752367) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is methyl 3-[(4-oxocyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-oxocyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 59752367 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | methyl 3-[(4-oxocyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1N(C(=O)C1CCC(=O)CC1)C(C)C |
| InChI | InChI=1S/C22H25NO4S/c1-14(2)23(21(25)16-9-11-17(24)12-10-16)18-13-19(15-7-5-4-6-8-15)28-20(18)22(26)27-3/h4-8,13-14,16H,9-12H2,1-3H3 |
| InChIKey | FRSWWNLPGVGCMM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |