C21H23NO4S — CID 10407746
3-[(5-methyl-3,6-dihydro-2H-pyran-2-carbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylic acid (PubChem CID 10407746) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[(5-methyl-3,6-dihydro-2H-pyran-2-carbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[(5-methyl-3,6-dihydro-2H-pyran-2-carbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 10407746 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-[(5-methyl-3,6-dihydro-2H-pyran-2-carbonyl)-propan-2-ylamino]-5-phenylthiophene-2-carboxylic acid |
| SMILES | CC1=CCC(C(=O)N(c2cc(-c3ccccc3)sc2C(=O)O)C(C)C)OC1 |
| InChI | InChI=1S/C21H23NO4S/c1-13(2)22(20(23)17-10-9-14(3)12-26-17)16-11-18(27-19(16)21(24)25)15-7-5-4-6-8-15/h4-9,11,13,17H,10,12H2,1-3H3,(H,24,25) |
| InChIKey | JDANFRFPRJRGFE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|