C22H27NO3S — CID 142192584
N-(2-formyl-5-phenylthiophen-3-yl)-3-methyl-N-propan-2-ylcyclopent-3-ene-1-carboxamide;methanol (PubChem CID 142192584) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-(2-formyl-5-phenylthiophen-3-yl)-3-methyl-N-propan-2-ylcyclopent-3-ene-1-carboxamide;methanol.
| Compound Name | N-(2-formyl-5-phenylthiophen-3-yl)-3-methyl-N-propan-2-ylcyclopent-3-ene-1-carboxamide;methanol |
|---|---|
| PubChem CID | 142192584 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-(2-formyl-5-phenylthiophen-3-yl)-3-methyl-N-propan-2-ylcyclopent-3-ene-1-carboxamide;methanol |
| SMILES | CC1=CCC(C(=O)N(c2cc(-c3ccccc3)sc2C=O)C(C)C)C1.CO |
| InChI | InChI=1S/C21H23NO2S.CH4O/c1-14(2)22(21(24)17-10-9-15(3)11-17)18-12-19(25-20(18)13-23)16-7-5-4-6-8-16;1-2/h4-9,12-14,17H,10-11H2,1-3H3;2H,1H3 |
| InChIKey | QJEGJISLIRFBSL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|