C23H29NO3S — CID 58869730
2-[(4-ethylcyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-3-carboxylic acid (PubChem CID 58869730) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-[(4-ethylcyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-3-carboxylic acid.
| Compound Name | 2-[(4-ethylcyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58869730 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[(4-ethylcyclohexanecarbonyl)-propan-2-ylamino]-5-phenylthiophene-3-carboxylic acid |
| SMILES | CCC1CCC(C(=O)N(c2sc(-c3ccccc3)cc2C(=O)O)C(C)C)CC1 |
| InChI | InChI=1S/C23H29NO3S/c1-4-16-10-12-18(13-11-16)21(25)24(15(2)3)22-19(23(26)27)14-20(28-22)17-8-6-5-7-9-17/h5-9,14-16,18H,4,10-13H2,1-3H3,(H,26,27) |
| InChIKey | JAAJASHEFOCCMW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |