C21H27NOS — CID 91384838
4-methyl-N-(5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 91384838) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is 4-methyl-N-(5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-methyl-N-(5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91384838 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-methyl-N-(5-phenylthiophen-3-yl)-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)N(c2csc(-c3ccccc3)c2)C(C)C)CC1 |
| InChI | InChI=1S/C21H27NOS/c1-15(2)22(21(23)18-11-9-16(3)10-12-18)19-13-20(24-14-19)17-7-5-4-6-8-17/h4-8,13-16,18H,9-12H2,1-3H3 |
| InChIKey | UNWDNZIPFMLKAU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |