C23H29NO2S2 — CID 142709258
4-methyl-N-(1-oxothian-4-yl)-N-(5-phenylthiophen-3-yl)cyclohexane-1-carboxamide (PubChem CID 142709258) has the molecular formula C23H29NO2S2 and a molecular weight of 415.62 g/mol. Its IUPAC name is 4-methyl-N-(1-oxothian-4-yl)-N-(5-phenylthiophen-3-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-methyl-N-(1-oxothian-4-yl)-N-(5-phenylthiophen-3-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142709258 |
| Molecular Formula | C23H29NO2S2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-methyl-N-(1-oxothian-4-yl)-N-(5-phenylthiophen-3-yl)cyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)N(c2csc(-c3ccccc3)c2)C2CCS(=O)CC2)CC1 |
| InChI | InChI=1S/C23H29NO2S2/c1-17-7-9-19(10-8-17)23(25)24(20-11-13-28(26)14-12-20)21-15-22(27-16-21)18-5-3-2-4-6-18/h2-6,15-17,19-20H,7-14H2,1H3 |
| InChIKey | FKFNDOASMFKXQQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |