C25H33NO3S — CID 58869714
ethyl 2-[3-cyclohexylpropanoyl(propan-2-yl)amino]-5-phenylthiophene-3-carboxylate (PubChem CID 58869714) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is ethyl 2-[3-cyclohexylpropanoyl(propan-2-yl)amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-cyclohexylpropanoyl(propan-2-yl)amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 58869714 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | ethyl 2-[3-cyclohexylpropanoyl(propan-2-yl)amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1N(C(=O)CCC1CCCCC1)C(C)C |
| InChI | InChI=1S/C25H33NO3S/c1-4-29-25(28)21-17-22(20-13-9-6-10-14-20)30-24(21)26(18(2)3)23(27)16-15-19-11-7-5-8-12-19/h6,9-10,13-14,17-19H,4-5,7-8,11-12,15-16H2,1-3H3 |
| InChIKey | MIQMKJNGJPNOER-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |